About N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride
N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride (PubChem CID 174153182) has the molecular formula C7H9ClF2N2
and a molecular weight of 194.61 g/mol. Its IUPAC name is N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride |
| PubChem CID | 174153182 |
| Molecular Formula | C7H9ClF2N2 |
| Molecular Weight | 194.61 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride |
| SMILES | C=C(C=N/C(Cl)=N/C)C(C)(F)F |
| InChI | InChI=1S/C7H9ClF2N2/c1-5(7(2,9)10)4-12-6(8)11-3/h4H,1H2,2-3H3/b11-6+,12-4? |
| InChIKey | YGYPRPNLIRSWKC-BDNUFDEPSA-N |
| XLogP | 2.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride?
The IUPAC name of N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride (CID 174153182) is N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride.
What is the SMILES notation for N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride?
The canonical SMILES for N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride is C=C(C=N/C(Cl)=N/C)C(C)(F)F.
What is the InChIKey of N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride?
The InChIKey is YGYPRPNLIRSWKC-BDNUFDEPSA-N. The full InChI is InChI=1S/C7H9ClF2N2/c1-5(7(2,9)10)4-12-6(8)11-3/h4H,1H2,2-3H3/b11-6+,12-4?.
What are the key properties of N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride?
N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride has a molecular weight of 194.61 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoro-2-methylidenebutylidene)-N'-methylcarbamimidoyl chloride is sourced from PubChem (CID 174153182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).