C11H18BN3O3S — CID 174156463
[4-[(4-hydroxycyclohexyl)amino]-2-methylsulfanylpyrimidin-5-yl]boronic acid (PubChem CID 174156463) has the molecular formula C11H18BN3O3S and a molecular weight of 283.16 g/mol. Its IUPAC name is [4-[(4-hydroxycyclohexyl)amino]-2-methylsulfanylpyrimidin-5-yl]boronic acid.
| Compound Name | [4-[(4-hydroxycyclohexyl)amino]-2-methylsulfanylpyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 174156463 |
| Molecular Formula | C11H18BN3O3S |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [4-[(4-hydroxycyclohexyl)amino]-2-methylsulfanylpyrimidin-5-yl]boronic acid |
| SMILES | CSc1ncc(B(O)O)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C11H18BN3O3S/c1-19-11-13-6-9(12(17)18)10(15-11)14-7-2-4-8(16)5-3-7/h6-8,16-18H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | AYWQHUARGPFLAI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|