C15H8I2O5 — CID 174157967
bis(4-iodo-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate (PubChem CID 174157967) has the molecular formula C15H8I2O5 and a molecular weight of 522.03 g/mol. Its IUPAC name is bis(4-iodo-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate.
| Compound Name | bis(4-iodo-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate |
|---|---|
| PubChem CID | 174157967 |
| Molecular Formula | C15H8I2O5 |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.85 |
| IUPAC Name | bis(4-iodo-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate |
| SMILES | O=C(Oc1ccc(I)ccc1=O)Oc1ccc(I)ccc1=O |
| InChI | InChI=1S/C15H8I2O5/c16-9-1-5-11(18)13(7-3-9)21-15(20)22-14-8-4-10(17)2-6-12(14)19/h1-8H |
| InChIKey | UBIZUBYUBRXBKZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|