C24H25FN2O4 — CID 174158024
[(2S,4S)-5-ethylidene-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-4-yl]carbamic acid (PubChem CID 174158024) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is [(2S,4S)-5-ethylidene-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-4-yl]carbamic acid.
| Compound Name | [(2S,4S)-5-ethylidene-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174158024 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [(2S,4S)-5-ethylidene-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-4-yl]carbamic acid |
| SMILES | CC=C1CO[C@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)C[C@@H]1NC(=O)O |
| InChI | InChI=1S/C24H25FN2O4/c1-2-15-14-31-21(13-20(15)26-24(29)30)23(28)27-12-11-16-5-3-4-6-19(16)22(27)17-7-9-18(25)10-8-17/h2-10,20-22,26H,11-14H2,1H3,(H,29,30)/t20-,21-,22-/m0/s1 |
| InChIKey | RGUUSLIOXGWINB-FKBYEOEOSA-N |
| XLogP | 3.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|