C11H9N3O2S — CID 174158222
8-methylsulfonyl-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 174158222) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 8-methylsulfonyl-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 8-methylsulfonyl-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 174158222 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 8-methylsulfonyl-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | CS(=O)(=O)c1ccc2ccc3nncn3c2c1 |
| InChI | InChI=1S/C11H9N3O2S/c1-17(15,16)9-4-2-8-3-5-11-13-12-7-14(11)10(8)6-9/h2-7H,1H3 |
| InChIKey | FPDNWVJFONBJNN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |