C16H17N5O2S — CID 126807001
7-methylsulfonyl-3-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 126807001) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 7-methylsulfonyl-3-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-methylsulfonyl-3-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 126807001 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 7-methylsulfonyl-3-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCN(c1cncc3nncn13)CC2 |
| InChI | InChI=1S/C16H17N5O2S/c1-24(22,23)14-3-2-12-4-6-20(7-5-13(12)8-14)16-10-17-9-15-19-18-11-21(15)16/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | QNSDNFOJLADJBF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |