C13H14Cl2N2 — CID 174160144
1H-phenalene-1,2-diamine;dihydrochloride (PubChem CID 174160144) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.18 g/mol. Its IUPAC name is 1H-phenalene-1,2-diamine;dihydrochloride.
| Compound Name | 1H-phenalene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 174160144 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1H-phenalene-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1=Cc2cccc3cccc(c23)C1N |
| InChI | InChI=1S/C13H12N2.2ClH/c14-11-7-9-5-1-3-8-4-2-6-10(12(8)9)13(11)15;;/h1-7,13H,14-15H2;2*1H |
| InChIKey | GWWUJNZYGMJFDC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |