About 1H-phenalene-1,2-diamine;dihydrochloride
1H-phenalene-1,2-diamine;dihydrochloride (PubChem CID 174160144) has the molecular formula C13H14Cl2N2
and a molecular weight of 269.18 g/mol. Its IUPAC name is 1H-phenalene-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1H-phenalene-1,2-diamine;dihydrochloride |
| PubChem CID | 174160144 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1H-phenalene-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1=Cc2cccc3cccc(c23)C1N |
| InChI | InChI=1S/C13H12N2.2ClH/c14-11-7-9-5-1-3-8-4-2-6-10(12(8)9)13(11)15;;/h1-7,13H,14-15H2;2*1H |
| InChIKey | GWWUJNZYGMJFDC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-phenalene-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenalene-1,2-diamine;dihydrochloride?
The IUPAC name of 1H-phenalene-1,2-diamine;dihydrochloride (CID 174160144) is 1H-phenalene-1,2-diamine;dihydrochloride.
What is the SMILES notation for 1H-phenalene-1,2-diamine;dihydrochloride?
The canonical SMILES for 1H-phenalene-1,2-diamine;dihydrochloride is Cl.Cl.NC1=Cc2cccc3cccc(c23)C1N.
What is the InChIKey of 1H-phenalene-1,2-diamine;dihydrochloride?
The InChIKey is GWWUJNZYGMJFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.2ClH/c14-11-7-9-5-1-3-8-4-2-6-10(12(8)9)13(11)15;;/h1-7,13H,14-15H2;2*1H.
What are the key properties of 1H-phenalene-1,2-diamine;dihydrochloride?
1H-phenalene-1,2-diamine;dihydrochloride has a molecular weight of 269.18 g/mol, XLogP of 3.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenalene-1,2-diamine;dihydrochloride is sourced from PubChem (CID 174160144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).