C22H17N3O4 — CID 174160802
[(1S)-1-[2-(6-formyl-1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylethyl]carbamic acid (PubChem CID 174160802) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is [(1S)-1-[2-(6-formyl-1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylethyl]carbamic acid.
| Compound Name | [(1S)-1-[2-(6-formyl-1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylethyl]carbamic acid |
|---|---|
| PubChem CID | 174160802 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [(1S)-1-[2-(6-formyl-1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylethyl]carbamic acid |
| SMILES | O=Cc1ccc2c(-c3ccccc3[C@H](Cc3ccccn3)NC(=O)O)noc2c1 |
| InChI | InChI=1S/C22H17N3O4/c26-13-14-8-9-18-20(11-14)29-25-21(18)17-7-2-1-6-16(17)19(24-22(27)28)12-15-5-3-4-10-23-15/h1-11,13,19,24H,12H2,(H,27,28)/t19-/m0/s1 |
| InChIKey | RQPYDTOWDUHLGG-IBGZPJMESA-N |
| XLogP | 4.25 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|