C26H25N3O3Si — CID 174200464
[2-pyridin-2-yl-1-[2-[6-(2-trimethylsilylethynyl)-1,2-benzoxazol-3-yl]phenyl]ethyl]carbamic acid (PubChem CID 174200464) has the molecular formula C26H25N3O3Si and a molecular weight of 455.59 g/mol. Its IUPAC name is [2-pyridin-2-yl-1-[2-[6-(2-trimethylsilylethynyl)-1,2-benzoxazol-3-yl]phenyl]ethyl]carbamic acid.
| Compound Name | [2-pyridin-2-yl-1-[2-[6-(2-trimethylsilylethynyl)-1,2-benzoxazol-3-yl]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 174200464 |
| Molecular Formula | C26H25N3O3Si |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [2-pyridin-2-yl-1-[2-[6-(2-trimethylsilylethynyl)-1,2-benzoxazol-3-yl]phenyl]ethyl]carbamic acid |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(-c3ccccc3C(Cc3ccccn3)NC(=O)O)noc2c1 |
| InChI | InChI=1S/C26H25N3O3Si/c1-33(2,3)15-13-18-11-12-22-24(16-18)32-29-25(22)21-10-5-4-9-20(21)23(28-26(30)31)17-19-8-6-7-14-27-19/h4-12,14,16,23,28H,17H2,1-3H3,(H,30,31) |
| InChIKey | FPSXHIOVUZGGAX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|