C12H15FN2O4 — CID 174161572
(3-fluoro-4-methyl-2-pyridinyl)-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid (PubChem CID 174161572) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is (3-fluoro-4-methyl-2-pyridinyl)-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid.
| Compound Name | (3-fluoro-4-methyl-2-pyridinyl)-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
|---|---|
| PubChem CID | 174161572 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (3-fluoro-4-methyl-2-pyridinyl)-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
| SMILES | Cc1ccnc(N(C(=O)O)C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C12H15FN2O4/c1-7-5-6-14-9(8(7)13)15(10(16)17)11(18)19-12(2,3)4/h5-6H,1-4H3,(H,16,17) |
| InChIKey | NYNVYXLDIRQKEH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |