C23H27NO — CID 174162731
(Z)-3-(2-methyl-5-prop-2-ynoxyphenyl)-N,N-bis(prop-2-ynyl)hept-3-en-1-amine (PubChem CID 174162731) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (Z)-3-(2-methyl-5-prop-2-ynoxyphenyl)-N,N-bis(prop-2-ynyl)hept-3-en-1-amine.
| Compound Name | (Z)-3-(2-methyl-5-prop-2-ynoxyphenyl)-N,N-bis(prop-2-ynyl)hept-3-en-1-amine |
|---|---|
| PubChem CID | 174162731 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (Z)-3-(2-methyl-5-prop-2-ynoxyphenyl)-N,N-bis(prop-2-ynyl)hept-3-en-1-amine |
| SMILES | C#CCOc1ccc(C)c(/C(=C\CCC)CCN(CC#C)CC#C)c1 |
| InChI | InChI=1S/C23H27NO/c1-6-10-11-21(14-17-24(15-7-2)16-8-3)23-19-22(25-18-9-4)13-12-20(23)5/h2-4,11-13,19H,6,10,14-18H2,1,5H3/b21-11- |
| InChIKey | FOLUIIRYCCOXTP-NHDPSOOVSA-N |
| XLogP | 4.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|