C25H19F3N5O2Si — CID 174163407
CID 174163407 (PubChem CID 174163407) has the molecular formula C25H19F3N5O2Si and a molecular weight of 506.54 g/mol.
| Compound Name | CID 174163407 |
|---|---|
| PubChem CID | 174163407 |
| Molecular Formula | C25H19F3N5O2Si |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | — |
| SMILES | C[C@]1([Si])Cn2ncc(C(=O)Nc3cccc(C#N)c3)c2C(=O)N1c1ccc(C(F)(F)C2(F)CC2)cc1 |
| InChI | InChI=1S/C25H19F3N5O2Si/c1-23(36)14-32-20(19(13-30-32)21(34)31-17-4-2-3-15(11-17)12-29)22(35)33(23)18-7-5-16(6-8-18)25(27,28)24(26)9-10-24/h2-8,11,13H,9-10,14H2,1H3,(H,31,34)/t23-/m0/s1 |
| InChIKey | XFRFYQKPYCWVQU-QHCPKHFHSA-N |
| XLogP | 4.15 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|