C23H16F5N5O2 — CID 174204390
N-(3-cyanophenyl)-6-methyl-4-oxo-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 174204390) has the molecular formula C23H16F5N5O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-6-methyl-4-oxo-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-6-methyl-4-oxo-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 174204390 |
| Molecular Formula | C23H16F5N5O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-(3-cyanophenyl)-6-methyl-4-oxo-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | CC1Cn2ncc(C(=O)Nc3cccc(C#N)c3)c2C(=O)N1c1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F5N5O2/c1-13-12-32-19(18(11-30-32)20(34)31-16-4-2-3-14(9-16)10-29)21(35)33(13)17-7-5-15(6-8-17)22(24,25)23(26,27)28/h2-9,11,13H,12H2,1H3,(H,31,34) |
| InChIKey | BVNNCQYHWMNNOQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|