C18H24N2O4S2 — CID 17416351
4-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 17416351) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17416351 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2CS(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-14(2)20-25(21,22)13-17-7-5-4-6-16(17)12-19-26(23,24)18-10-8-15(3)9-11-18/h4-11,14,19-20H,12-13H2,1-3H3 |
| InChIKey | KUSGQLICMWVLHR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |