C18H23ClN2O4S2 — CID 34050535
5-chloro-2-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 34050535) has the molecular formula C18H23ClN2O4S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34050535 |
| Molecular Formula | C18H23ClN2O4S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 5-chloro-2-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCc1ccccc1CS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C18H23ClN2O4S2/c1-13(2)21-26(22,23)12-16-7-5-4-6-15(16)11-20-27(24,25)18-10-17(19)9-8-14(18)3/h4-10,13,20-21H,11-12H2,1-3H3 |
| InChIKey | RAOXQDDVYCAYCL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |