C14H22N4O2 — CID 17416415
N-[(2,3-dimethylcyclohexyl)carbamoyl]-2-imidazol-1-ylacetamide (PubChem CID 17416415) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(2,3-dimethylcyclohexyl)carbamoyl]-2-imidazol-1-ylacetamide.
| Compound Name | N-[(2,3-dimethylcyclohexyl)carbamoyl]-2-imidazol-1-ylacetamide |
|---|---|
| PubChem CID | 17416415 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[(2,3-dimethylcyclohexyl)carbamoyl]-2-imidazol-1-ylacetamide |
| SMILES | CC1CCCC(NC(=O)NC(=O)Cn2ccnc2)C1C |
| InChI | InChI=1S/C14H22N4O2/c1-10-4-3-5-12(11(10)2)16-14(20)17-13(19)8-18-7-6-15-9-18/h6-7,9-12H,3-5,8H2,1-2H3,(H2,16,17,19,20) |
| InChIKey | CXRNJQIHRJHFQY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |