C15H24N4O2S3 — CID 40633300
N-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]carbamoyl]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 40633300) has the molecular formula C15H24N4O2S3 and a molecular weight of 388.58 g/mol. Its IUPAC name is N-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]carbamoyl]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]carbamoyl]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 40633300 |
| Molecular Formula | C15H24N4O2S3 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]carbamoyl]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCSc1nnc(SCC(=O)NC(=O)N[C@@H]2CCC[C@H](C)[C@@H]2C)s1 |
| InChI | InChI=1S/C15H24N4O2S3/c1-4-22-14-18-19-15(24-14)23-8-12(20)17-13(21)16-11-7-5-6-9(2)10(11)3/h9-11H,4-8H2,1-3H3,(H2,16,17,20,21)/t9-,10-,11+/m0/s1 |
| InChIKey | FTMMBUCCXDYWLU-GARJFASQSA-N |
| XLogP | 3.39 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |