C17H28N4O2S3 — CID 11926389
2-[[5-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 11926389) has the molecular formula C17H28N4O2S3 and a molecular weight of 416.64 g/mol. Its IUPAC name is 2-[[5-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[5-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 11926389 |
| Molecular Formula | C17H28N4O2S3 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[[5-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nnc(SCC(=O)N[C@H]2CCC[C@@H](C)[C@@H]2C)s1 |
| InChI | InChI=1S/C17H28N4O2S3/c1-4-8-18-14(22)9-24-16-20-21-17(26-16)25-10-15(23)19-13-7-5-6-11(2)12(13)3/h11-13H,4-10H2,1-3H3,(H,18,22)(H,19,23)/t11-,12+,13+/m1/s1 |
| InChIKey | BMTQSNAZUCPWJA-AGIUHOORSA-N |
| XLogP | 3.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |