C10H14N2O4S3 — CID 174164600
3-[2-[disulfanyl(methyl)amino]ethylsulfamoyl]benzoic acid (PubChem CID 174164600) has the molecular formula C10H14N2O4S3 and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-[2-[disulfanyl(methyl)amino]ethylsulfamoyl]benzoic acid.
| Compound Name | 3-[2-[disulfanyl(methyl)amino]ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 174164600 |
| Molecular Formula | C10H14N2O4S3 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-[2-[disulfanyl(methyl)amino]ethylsulfamoyl]benzoic acid |
| SMILES | CN(CCNS(=O)(=O)c1cccc(C(=O)O)c1)SS |
| InChI | InChI=1S/C10H14N2O4S3/c1-12(18-17)6-5-11-19(15,16)9-4-2-3-8(7-9)10(13)14/h2-4,7,11,17H,5-6H2,1H3,(H,13,14) |
| InChIKey | HVILYEPZNHTEHE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|