C18H26N2O7S — CID 66797539
3-[[3-[2-(dipropylamino)-2-oxoethoxy]-3-oxopropyl]sulfamoyl]benzoic acid (PubChem CID 66797539) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-[[3-[2-(dipropylamino)-2-oxoethoxy]-3-oxopropyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[3-[2-(dipropylamino)-2-oxoethoxy]-3-oxopropyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66797539 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-[[3-[2-(dipropylamino)-2-oxoethoxy]-3-oxopropyl]sulfamoyl]benzoic acid |
| SMILES | CCCN(CCC)C(=O)COC(=O)CCNS(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H26N2O7S/c1-3-10-20(11-4-2)16(21)13-27-17(22)8-9-19-28(25,26)15-7-5-6-14(12-15)18(23)24/h5-7,12,19H,3-4,8-11,13H2,1-2H3,(H,23,24) |
| InChIKey | ZTEJVXPWQMYTDA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |