C17H24N2O6S — CID 8630943
[2-(tert-butylamino)-2-oxoethyl] 3-[(3-acetylphenyl)sulfonylamino]propanoate (PubChem CID 8630943) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-[(3-acetylphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-[(3-acetylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8630943 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-[(3-acetylphenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCCC(=O)OCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N2O6S/c1-12(20)13-6-5-7-14(10-13)26(23,24)18-9-8-16(22)25-11-15(21)19-17(2,3)4/h5-7,10,18H,8-9,11H2,1-4H3,(H,19,21) |
| InChIKey | IXRPOJNCOXQQLT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |