C14H19NO4S — CID 64994049
3-acetyl-N-(3,3-dimethyl-2-oxobutyl)benzenesulfonamide (PubChem CID 64994049) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-acetyl-N-(3,3-dimethyl-2-oxobutyl)benzenesulfonamide.
| Compound Name | 3-acetyl-N-(3,3-dimethyl-2-oxobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64994049 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-acetyl-N-(3,3-dimethyl-2-oxobutyl)benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-10(16)11-6-5-7-12(8-11)20(18,19)15-9-13(17)14(2,3)4/h5-8,15H,9H2,1-4H3 |
| InChIKey | ZPGMPUKHUSLJPX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |