C17H26N2O5S — CID 110669033
tert-butyl N-[1-[(3-acetylphenyl)sulfonylamino]-2-methylpropan-2-yl]carbamate (PubChem CID 110669033) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-acetylphenyl)sulfonylamino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-acetylphenyl)sulfonylamino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 110669033 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | tert-butyl N-[1-[(3-acetylphenyl)sulfonylamino]-2-methylpropan-2-yl]carbamate |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCC(C)(C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O5S/c1-12(20)13-8-7-9-14(10-13)25(22,23)18-11-17(5,6)19-15(21)24-16(2,3)4/h7-10,18H,11H2,1-6H3,(H,19,21) |
| InChIKey | UOIMHQLYGULONP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |