C23H19Cl2N5O — CID 174164712
N-[(3R)-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]benzamide (PubChem CID 174164712) has the molecular formula C23H19Cl2N5O and a molecular weight of 452.35 g/mol. Its IUPAC name is N-[(3R)-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]benzamide.
| Compound Name | N-[(3R)-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 174164712 |
| Molecular Formula | C23H19Cl2N5O |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[(3R)-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCN(c2cc(-n3ccnc3)c3ccc(Cl)c(Cl)c3n2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N5O/c24-18-7-6-17-19(30-11-9-26-14-30)12-20(28-22(17)21(18)25)29-10-8-16(13-29)27-23(31)15-4-2-1-3-5-15/h1-7,9,11-12,14,16H,8,10,13H2,(H,27,31)/t16-/m1/s1 |
| InChIKey | PYDIRQKWKJCXPI-MRXNPFEDSA-N |
| XLogP | 4.74 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |