C17H17Cl2N5 — CID 169001726
1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)piperidin-3-amine (PubChem CID 169001726) has the molecular formula C17H17Cl2N5 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)piperidin-3-amine.
| Compound Name | 1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 169001726 |
| Molecular Formula | C17H17Cl2N5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)piperidin-3-amine |
| SMILES | NC1CCCN(c2cc(-n3ccnc3)c3ccc(Cl)c(Cl)c3n2)C1 |
| InChI | InChI=1S/C17H17Cl2N5/c18-13-4-3-12-14(24-7-5-21-10-24)8-15(22-17(12)16(13)19)23-6-1-2-11(20)9-23/h3-5,7-8,10-11H,1-2,6,9,20H2 |
| InChIKey | LVVZRCYKHWTNOH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |