C17H17Cl2N5O2S — CID 162751460
[1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 162751460) has the molecular formula C17H17Cl2N5O2S and a molecular weight of 426.33 g/mol. Its IUPAC name is [1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 162751460 |
| Molecular Formula | C17H17Cl2N5O2S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CCN(c2cc(-n3ccnc3)c3ccc(Cl)c(Cl)c3n2)C1 |
| InChI | InChI=1S/C17H17Cl2N5O2S/c18-13-2-1-12-14(24-6-4-21-10-24)7-15(22-17(12)16(13)19)23-5-3-11(8-23)9-27(20,25)26/h1-2,4,6-7,10-11H,3,5,8-9H2,(H2,20,25,26) |
| InChIKey | TZYSDIXAOQFVGA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |