C32H36F3N9O4 — CID 174166686
2-[3,5-bis[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl]-1,2,4-triazol-4-yl]ethyl 2,2,2-trifluoroacetate (PubChem CID 174166686) has the molecular formula C32H36F3N9O4 and a molecular weight of 667.69 g/mol. Its IUPAC name is 2-[3,5-bis[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl]-1,2,4-triazol-4-yl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[3,5-bis[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl]-1,2,4-triazol-4-yl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174166686 |
| Molecular Formula | C32H36F3N9O4 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 2-[3,5-bis[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl]-1,2,4-triazol-4-yl]ethyl 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)N1CC=C(c2ccc(-c3nnc(-c4ccc(C5=CCN(/C(N)=N/[H])CC5)cc4OC)n3CCOC(=O)C(F)(F)F)c(OC)c2)CC1 |
| InChI | InChI=1S/C32H36F3N9O4/c1-46-25-17-21(19-7-11-42(12-8-19)30(36)37)3-5-23(25)27-40-41-28(44(27)15-16-48-29(45)32(33,34)35)24-6-4-22(18-26(24)47-2)20-9-13-43(14-10-20)31(38)39/h3-7,9,17-18H,8,10-16H2,1-2H3,(H3,36,37)(H3,38,39) |
| InChIKey | YRBONHBGHXRPRU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 181.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|