C25H24ClF3N2O3 — CID 174169653
(2R)-6-chloro-N-[(1S,2R,4S,5R)-5-[[4-(trifluoromethyl)benzoyl]amino]-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 174169653) has the molecular formula C25H24ClF3N2O3 and a molecular weight of 492.93 g/mol. Its IUPAC name is (2R)-6-chloro-N-[(1S,2R,4S,5R)-5-[[4-(trifluoromethyl)benzoyl]amino]-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R)-6-chloro-N-[(1S,2R,4S,5R)-5-[[4-(trifluoromethyl)benzoyl]amino]-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 174169653 |
| Molecular Formula | C25H24ClF3N2O3 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (2R)-6-chloro-N-[(1S,2R,4S,5R)-5-[[4-(trifluoromethyl)benzoyl]amino]-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@@H]2C[C@H]1C[C@H]2NC(=O)[C@H]1CCc2cc(Cl)ccc2O1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24ClF3N2O3/c26-18-6-8-21-14(10-18)3-7-22(34-21)24(33)31-20-12-15-9-16(20)11-19(15)30-23(32)13-1-4-17(5-2-13)25(27,28)29/h1-2,4-6,8,10,15-16,19-20,22H,3,7,9,11-12H2,(H,30,32)(H,31,33)/t15-,16-,19+,20+,22+/m0/s1 |
| InChIKey | FCOHBZFZIBWZJD-COZQAFJOSA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |