C45H28N4O6 — CID 174170243
6-[4-phenyl-6-[4-(2-phenylcarbazol-9-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 174170243) has the molecular formula C45H28N4O6 and a molecular weight of 720.74 g/mol. Its IUPAC name is 6-[4-phenyl-6-[4-(2-phenylcarbazol-9-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-phenyl-6-[4-(2-phenylcarbazol-9-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174170243 |
| Molecular Formula | C45H28N4O6 |
| Molecular Weight | 720.74 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | 6-[4-phenyl-6-[4-(2-phenylcarbazol-9-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccc(-c6ccccc6)cc54)c4oc5ccccc5c34)n2)c(O)c1O |
| InChI | InChI=1S/C45H28N4O6/c50-37-36(38(51)40(53)41(54)39(37)52)45-47-43(25-13-5-2-6-14-25)46-44(48-45)30-21-22-32(42-35(30)29-16-8-10-18-34(29)55-42)49-31-17-9-7-15-27(31)28-20-19-26(23-33(28)49)24-11-3-1-4-12-24/h1-23,50-54H |
| InChIKey | GQGIXPSKBUOKKB-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.74 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|