C57H36N4O6 — CID 174169382
6-[4-[2,7-diphenyl-9-(3-phenylcarbazol-9-yl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 174169382) has the molecular formula C57H36N4O6 and a molecular weight of 872.94 g/mol. Its IUPAC name is 6-[4-[2,7-diphenyl-9-(3-phenylcarbazol-9-yl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-[2,7-diphenyl-9-(3-phenylcarbazol-9-yl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174169382 |
| Molecular Formula | C57H36N4O6 |
| Molecular Weight | 872.94 g/mol |
| Exact Mass | 872.26 |
| IUPAC Name | 6-[4-[2,7-diphenyl-9-(3-phenylcarbazol-9-yl)dibenzofuran-4-yl]-6-phenyl-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccccc4)cc4c3oc3cc(-c5ccccc5)cc(-n5c6ccccc6c6cc(-c7ccccc7)ccc65)c34)n2)c(O)c1O |
| InChI | InChI=1S/C57H36N4O6/c62-49-48(50(63)52(65)53(66)51(49)64)57-59-55(35-21-11-4-12-22-35)58-56(60-57)42-29-37(33-17-7-2-8-18-33)28-41-47-45(30-38(31-46(47)67-54(41)42)34-19-9-3-10-20-34)61-43-24-14-13-23-39(43)40-27-36(25-26-44(40)61)32-15-5-1-6-16-32/h1-31,62-66H |
| InChIKey | JNAWTVJCXVSCBX-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.94 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|