C26H25F2N3O4 — CID 174170772
6-[[(1R)-1-[3,6-dimethyl-2-(1-methylpyrrol-3-yl)-4-oxochromen-8-yl]ethyl]amino]-2,3-difluoro-N-methoxybenzamide (PubChem CID 174170772) has the molecular formula C26H25F2N3O4 and a molecular weight of 481.50 g/mol. Its IUPAC name is 6-[[(1R)-1-[3,6-dimethyl-2-(1-methylpyrrol-3-yl)-4-oxochromen-8-yl]ethyl]amino]-2,3-difluoro-N-methoxybenzamide.
| Compound Name | 6-[[(1R)-1-[3,6-dimethyl-2-(1-methylpyrrol-3-yl)-4-oxochromen-8-yl]ethyl]amino]-2,3-difluoro-N-methoxybenzamide |
|---|---|
| PubChem CID | 174170772 |
| Molecular Formula | C26H25F2N3O4 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 6-[[(1R)-1-[3,6-dimethyl-2-(1-methylpyrrol-3-yl)-4-oxochromen-8-yl]ethyl]amino]-2,3-difluoro-N-methoxybenzamide |
| SMILES | CONC(=O)c1c(N[C@H](C)c2cc(C)cc3c(=O)c(C)c(-c4ccn(C)c4)oc23)ccc(F)c1F |
| InChI | InChI=1S/C26H25F2N3O4/c1-13-10-17(15(3)29-20-7-6-19(27)22(28)21(20)26(33)30-34-5)25-18(11-13)23(32)14(2)24(35-25)16-8-9-31(4)12-16/h6-12,15,29H,1-5H3,(H,30,33)/t15-/m1/s1 |
| InChIKey | KPWBMTXUBXQZNX-OAHLLOKOSA-N |
| XLogP | 5.16 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|