C31H31F2N3O5 — CID 169268694
tert-butyl N-[[6-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2,3-difluorobenzoyl]amino]carbamate (PubChem CID 169268694) has the molecular formula C31H31F2N3O5 and a molecular weight of 563.60 g/mol. Its IUPAC name is tert-butyl N-[[6-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2,3-difluorobenzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[6-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2,3-difluorobenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 169268694 |
| Molecular Formula | C31H31F2N3O5 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | tert-butyl N-[[6-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-2,3-difluorobenzoyl]amino]carbamate |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(F)c(F)c2C(=O)NNC(=O)OC(C)(C)C)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C31H31F2N3O5/c1-16-14-20(28-21(15-16)26(37)17(2)27(40-28)19-10-8-7-9-11-19)18(3)34-23-13-12-22(32)25(33)24(23)29(38)35-36-30(39)41-31(4,5)6/h7-15,18,34H,1-6H3,(H,35,38)(H,36,39)/t18-/m1/s1 |
| InChIKey | FRYNGMHPWGSGHO-GOSISDBHSA-N |
| XLogP | 6.70 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|