C11H11N3O5S — CID 174172053
1-amino-5-(4-methylphenyl)-4-sulfopyrazole-3-carboxylic acid (PubChem CID 174172053) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is 1-amino-5-(4-methylphenyl)-4-sulfopyrazole-3-carboxylic acid.
| Compound Name | 1-amino-5-(4-methylphenyl)-4-sulfopyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 174172053 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-amino-5-(4-methylphenyl)-4-sulfopyrazole-3-carboxylic acid |
| SMILES | Cc1ccc(-c2c(S(=O)(=O)O)c(C(=O)O)nn2N)cc1 |
| InChI | InChI=1S/C11H11N3O5S/c1-6-2-4-7(5-3-6)9-10(20(17,18)19)8(11(15)16)13-14(9)12/h2-5H,12H2,1H3,(H,15,16)(H,17,18,19) |
| InChIKey | AASQNFOWYZHPGK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|