C12H19N4O3S+ — CID 126959528
4-methylbenzenesulfonic acid;1,3,5-trimethyl-1,2,4-triazol-4-ium-4-amine (PubChem CID 126959528) has the molecular formula C12H19N4O3S+ and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;1,3,5-trimethyl-1,2,4-triazol-4-ium-4-amine.
| Compound Name | 4-methylbenzenesulfonic acid;1,3,5-trimethyl-1,2,4-triazol-4-ium-4-amine |
|---|---|
| PubChem CID | 126959528 |
| Molecular Formula | C12H19N4O3S+ |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;1,3,5-trimethyl-1,2,4-triazol-4-ium-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1nn(C)c(C)[n+]1N |
| InChI | InChI=1S/C7H8O3S.C5H11N4/c1-6-2-4-7(5-3-6)11(8,9)10;1-4-7-8(3)5(2)9(4)6/h2-5H,1H3,(H,8,9,10);6H2,1-3H3/q;+1 |
| InChIKey | BJQVRCAVKMKZMH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|