C22H22N2O7S2 — CID 174172745
3-[[3-[[4-(2-methoxyethoxy)phenyl]-methylsulfamoyl]thiophene-2-carbonyl]amino]benzoic acid (PubChem CID 174172745) has the molecular formula C22H22N2O7S2 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[[3-[[4-(2-methoxyethoxy)phenyl]-methylsulfamoyl]thiophene-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[3-[[4-(2-methoxyethoxy)phenyl]-methylsulfamoyl]thiophene-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174172745 |
| Molecular Formula | C22H22N2O7S2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 3-[[3-[[4-(2-methoxyethoxy)phenyl]-methylsulfamoyl]thiophene-2-carbonyl]amino]benzoic acid |
| SMILES | COCCOc1ccc(N(C)S(=O)(=O)c2ccsc2C(=O)Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H22N2O7S2/c1-24(17-6-8-18(9-7-17)31-12-11-30-2)33(28,29)19-10-13-32-20(19)21(25)23-16-5-3-4-15(14-16)22(26)27/h3-10,13-14H,11-12H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | HUQQFCCBEGUYIH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|