C25H22N2O5S2 — CID 53061856
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(4-phenoxyphenyl)thiophene-2-carboxamide (PubChem CID 53061856) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(4-phenoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(4-phenoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53061856 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(4-phenoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2ccsc2C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-27(19-10-14-20(31-2)15-11-19)34(29,30)23-16-17-33-24(23)25(28)26-18-8-12-22(13-9-18)32-21-6-4-3-5-7-21/h3-17H,1-2H3,(H,26,28) |
| InChIKey | MPXMGHTWSNJXIM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |