C18H23N3O4S — CID 17417410
1-[2-(3,5-dimethylphenoxy)ethyl]-1-methyl-3-(4-sulfamoylphenyl)urea (PubChem CID 17417410) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-1-methyl-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-1-methyl-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 17417410 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-1-methyl-3-(4-sulfamoylphenyl)urea |
| SMILES | Cc1cc(C)cc(OCCN(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-13-10-14(2)12-16(11-13)25-9-8-21(3)18(22)20-15-4-6-17(7-5-15)26(19,23)24/h4-7,10-12H,8-9H2,1-3H3,(H,20,22)(H2,19,23,24) |
| InChIKey | UOKXKUZFTBBUAO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |