C23H30ClF3N2O3 — CID 174176534
(3R)-4-acetyl-3-[2-(2-chlorophenyl)ethyl]-1-[[(1-cyclohexyl-2,2,2-trifluoroethyl)amino]-methoxymethyl]azetidin-2-one (PubChem CID 174176534) has the molecular formula C23H30ClF3N2O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is (3R)-4-acetyl-3-[2-(2-chlorophenyl)ethyl]-1-[[(1-cyclohexyl-2,2,2-trifluoroethyl)amino]-methoxymethyl]azetidin-2-one.
| Compound Name | (3R)-4-acetyl-3-[2-(2-chlorophenyl)ethyl]-1-[[(1-cyclohexyl-2,2,2-trifluoroethyl)amino]-methoxymethyl]azetidin-2-one |
|---|---|
| PubChem CID | 174176534 |
| Molecular Formula | C23H30ClF3N2O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (3R)-4-acetyl-3-[2-(2-chlorophenyl)ethyl]-1-[[(1-cyclohexyl-2,2,2-trifluoroethyl)amino]-methoxymethyl]azetidin-2-one |
| SMILES | COC(NC(C1CCCCC1)C(F)(F)F)N1C(=O)[C@H](CCc2ccccc2Cl)C1C(C)=O |
| InChI | InChI=1S/C23H30ClF3N2O3/c1-14(30)19-17(13-12-15-8-6-7-11-18(15)24)21(31)29(19)22(32-2)28-20(23(25,26)27)16-9-4-3-5-10-16/h6-8,11,16-17,19-20,22,28H,3-5,9-10,12-13H2,1-2H3/t17-,19?,20?,22?/m1/s1 |
| InChIKey | UEWZZWHLLAYRCG-KWDOIIOISA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|