C18H24N3O3P — CID 174179272
5-N-ethyl-2-N-methyl-3-[1-(4-methyl-2-phosphanylphenyl)ethoxy]-1H-pyrrole-2,5-dicarboxamide (PubChem CID 174179272) has the molecular formula C18H24N3O3P and a molecular weight of 361.38 g/mol. Its IUPAC name is 5-N-ethyl-2-N-methyl-3-[1-(4-methyl-2-phosphanylphenyl)ethoxy]-1H-pyrrole-2,5-dicarboxamide.
| Compound Name | 5-N-ethyl-2-N-methyl-3-[1-(4-methyl-2-phosphanylphenyl)ethoxy]-1H-pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 174179272 |
| Molecular Formula | C18H24N3O3P |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 5-N-ethyl-2-N-methyl-3-[1-(4-methyl-2-phosphanylphenyl)ethoxy]-1H-pyrrole-2,5-dicarboxamide |
| SMILES | CCNC(=O)c1cc(OC(C)c2ccc(C)cc2P)c(C(=O)NC)[nH]1 |
| InChI | InChI=1S/C18H24N3O3P/c1-5-20-17(22)13-9-14(16(21-13)18(23)19-4)24-11(3)12-7-6-10(2)8-15(12)25/h6-9,11,21H,5,25H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | HBAONTLGLWKJPJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|