amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate

C10H19NO2 — CID 174179934

IUPACamino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate
SMILESC=C(C)C(CC(C)(C)C)C(=O)ON
InChIInChI=1S/C10H19NO2/c1-7(2)8(9(12)13-11)6-10(3,4)5/h8H,1,6,11H2,2-5H3
InChIKeyDTAIPERGZKCNGF-UHFFFAOYSA-N
MW185.27 g/mol
LogP2.03
Rot. Bonds3

About amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate

amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate (PubChem CID 174179934) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate.

Molecular Properties

Compound Nameamino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate
PubChem CID174179934
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Nameamino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate
SMILESC=C(C)C(CC(C)(C)C)C(=O)ON
InChIInChI=1S/C10H19NO2/c1-7(2)8(9(12)13-11)6-10(3,4)5/h8H,1,6,11H2,2-5H3
InChIKeyDTAIPERGZKCNGF-UHFFFAOYSA-N
XLogP2.03
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate?
The IUPAC name of amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate (CID 174179934) is amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate.
What is the SMILES notation for amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate?
The canonical SMILES for amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate is C=C(C)C(CC(C)(C)C)C(=O)ON.
What is the InChIKey of amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate?
The InChIKey is DTAIPERGZKCNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-7(2)8(9(12)13-11)6-10(3,4)5/h8H,1,6,11H2,2-5H3.
What are the key properties of amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate?
amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate has a molecular weight of 185.27 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4,4-dimethyl-2-prop-1-en-2-ylpentanoate is sourced from PubChem (CID 174179934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).