C13H16N4 — CID 174180954
2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methylpyridine-4-carbonitrile (PubChem CID 174180954) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methylpyridine-4-carbonitrile.
| Compound Name | 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 174180954 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methylpyridine-4-carbonitrile |
| SMILES | Cc1c(C#N)ccnc1N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C13H16N4/c1-9-10(4-14)2-3-16-13(9)17-7-11-5-15-6-12(11)8-17/h2-3,11-12,15H,5-8H2,1H3/t11-,12+ |
| InChIKey | VDXUHTLVTWCJRD-TXEJJXNPSA-N |
| XLogP | 0.92 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |