C29H38Cl2N6O3 — CID 174181736
2-[1-[[2-[(1E,3E)-1,4-diamino-4-(4-ethylpiperazin-1-yl)buta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-4-pyridinyl]methyl]piperidin-4-yl]acetic acid (PubChem CID 174181736) has the molecular formula C29H38Cl2N6O3 and a molecular weight of 589.57 g/mol. Its IUPAC name is 2-[1-[[2-[(1E,3E)-1,4-diamino-4-(4-ethylpiperazin-1-yl)buta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-4-pyridinyl]methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[[2-[(1E,3E)-1,4-diamino-4-(4-ethylpiperazin-1-yl)buta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-4-pyridinyl]methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 174181736 |
| Molecular Formula | C29H38Cl2N6O3 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 2-[1-[[2-[(1E,3E)-1,4-diamino-4-(4-ethylpiperazin-1-yl)buta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-4-pyridinyl]methyl]piperidin-4-yl]acetic acid |
| SMILES | CCN1CCN(/C(N)=C/C=C(\N)Oc2cc(CN3CCC(CC(=O)O)CC3)cc(-c3cc(Cl)cc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C29H38Cl2N6O3/c1-2-35-9-11-37(12-10-35)26(32)3-4-27(33)40-28-14-21(19-36-7-5-20(6-8-36)15-29(38)39)13-25(34-28)22-16-23(30)18-24(31)17-22/h3-4,13-14,16-18,20H,2,5-12,15,19,32-33H2,1H3,(H,38,39)/b26-3+,27-4+ |
| InChIKey | PCBXOASCTQCBBQ-UGBLGBQVSA-N |
| XLogP | 4.36 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|