C25H29Cl3N4O3 — CID 146251839
methyl 2-[1-[[2-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-3-methyl-4-pyridinyl]methyl]piperidin-4-yl]acetate (PubChem CID 146251839) has the molecular formula C25H29Cl3N4O3 and a molecular weight of 539.89 g/mol. Its IUPAC name is methyl 2-[1-[[2-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-3-methyl-4-pyridinyl]methyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[[2-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-3-methyl-4-pyridinyl]methyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 146251839 |
| Molecular Formula | C25H29Cl3N4O3 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | methyl 2-[1-[[2-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienoxy]-6-(3,5-dichlorophenyl)-3-methyl-4-pyridinyl]methyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(Cc2cc(-c3cc(Cl)cc(Cl)c3)nc(O/C(N)=C/C=C(\N)Cl)c2C)CC1 |
| InChI | InChI=1S/C25H29Cl3N4O3/c1-15-18(14-32-7-5-16(6-8-32)9-24(33)34-2)12-21(17-10-19(26)13-20(27)11-17)31-25(15)35-23(30)4-3-22(28)29/h3-4,10-13,16H,5-9,14,29-30H2,1-2H3/b22-3-,23-4+ |
| InChIKey | KUPHOVDGWKCMDQ-KQOZZNSWSA-N |
| XLogP | 5.36 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|