C23H23N5O — CID 174183154
3-(6-cyclohexa-2,4-dien-1-yloxy-2-piperazin-1-ylpyrimidin-4-yl)quinoline (PubChem CID 174183154) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-(6-cyclohexa-2,4-dien-1-yloxy-2-piperazin-1-ylpyrimidin-4-yl)quinoline.
| Compound Name | 3-(6-cyclohexa-2,4-dien-1-yloxy-2-piperazin-1-ylpyrimidin-4-yl)quinoline |
|---|---|
| PubChem CID | 174183154 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-(6-cyclohexa-2,4-dien-1-yloxy-2-piperazin-1-ylpyrimidin-4-yl)quinoline |
| SMILES | C1=CCC(Oc2cc(-c3cnc4ccccc4c3)nc(N3CCNCC3)n2)C=C1 |
| InChI | InChI=1S/C23H23N5O/c1-2-7-19(8-3-1)29-22-15-21(26-23(27-22)28-12-10-24-11-13-28)18-14-17-6-4-5-9-20(17)25-16-18/h1-7,9,14-16,19,24H,8,10-13H2 |
| InChIKey | LIGDMRFXSQKTLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |