C15H14F3N3O — CID 174185294
cyclopropyl-[(5S,7S)-5-(2,3-difluorocyclohexa-2,4-dien-1-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 174185294) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is cyclopropyl-[(5S,7S)-5-(2,3-difluorocyclohexa-2,4-dien-1-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[(5S,7S)-5-(2,3-difluorocyclohexa-2,4-dien-1-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 174185294 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | cyclopropyl-[(5S,7S)-5-(2,3-difluorocyclohexa-2,4-dien-1-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | O=C(c1nc2n(n1)[C@H](C1CC=CC(F)=C1F)C[C@@H]2F)C1CC1 |
| InChI | InChI=1S/C15H14F3N3O/c16-9-3-1-2-8(12(9)18)11-6-10(17)15-19-14(20-21(11)15)13(22)7-4-5-7/h1,3,7-8,10-11H,2,4-6H2/t8?,10-,11-/m0/s1 |
| InChIKey | LJUHGNVHGUIDBB-CSUXEGHOSA-N |
| XLogP | 3.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |