C16H19F2N3O — CID 142515020
cyclopropyl-[7-fluoro-5-[(2E,4Z)-3-fluorohepta-2,4-dien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 142515020) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is cyclopropyl-[7-fluoro-5-[(2E,4Z)-3-fluorohepta-2,4-dien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[7-fluoro-5-[(2E,4Z)-3-fluorohepta-2,4-dien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 142515020 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | cyclopropyl-[7-fluoro-5-[(2E,4Z)-3-fluorohepta-2,4-dien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | C/C=C(F)\C(=C/CC)C1CC(F)c2nc(C(=O)C3CC3)nn21 |
| InChI | InChI=1S/C16H19F2N3O/c1-3-5-10(11(17)4-2)13-8-12(18)16-19-15(20-21(13)16)14(22)9-6-7-9/h4-5,9,12-13H,3,6-8H2,1-2H3/b10-5+,11-4+ |
| InChIKey | UUFRHRLCXRJJPG-HRCIMPOESA-N |
| XLogP | 4.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|