C27H27N3O7S — CID 174188593
(2S)-2,6-diaminohexanoic acid;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;isothiocyanic acid (PubChem CID 174188593) has the molecular formula C27H27N3O7S and a molecular weight of 537.59 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;isothiocyanic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;isothiocyanic acid |
|---|---|
| PubChem CID | 174188593 |
| Molecular Formula | C27H27N3O7S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;isothiocyanic acid |
| SMILES | N=C=S.NCCCC[C@H](N)C(=O)O.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C6H14N2O2.CHNS/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;7-4-2-1-3-5(8)6(9)10;2-1-3/h1-10,21-22H;5H,1-4,7-8H2,(H,9,10);2H/t;5-;/m.0./s1 |
| InChIKey | GFRIJXJOVHEBSW-NXAOXGSFSA-N |
| XLogP | 3.86 |
| TPSA | 189.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|