C20H19ClFN3O4 — CID 174189270
5-amino-4-[6-[4-(chloromethyl)-2-pyridinyl]-7-fluoro-1-methyl-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid (PubChem CID 174189270) has the molecular formula C20H19ClFN3O4 and a molecular weight of 419.84 g/mol. Its IUPAC name is 5-amino-4-[6-[4-(chloromethyl)-2-pyridinyl]-7-fluoro-1-methyl-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[6-[4-(chloromethyl)-2-pyridinyl]-7-fluoro-1-methyl-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174189270 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 5-amino-4-[6-[4-(chloromethyl)-2-pyridinyl]-7-fluoro-1-methyl-3-oxo-1H-isoindol-2-yl]-5-oxopentanoic acid |
| SMILES | CC1c2c(ccc(-c3cc(CCl)ccn3)c2F)C(=O)N1C(CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C20H19ClFN3O4/c1-10-17-13(20(29)25(10)15(19(23)28)4-5-16(26)27)3-2-12(18(17)22)14-8-11(9-21)6-7-24-14/h2-3,6-8,10,15H,4-5,9H2,1H3,(H2,23,28)(H,26,27) |
| InChIKey | CODGAWPRWRCOHT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|