C15H18N2O7S2 — CID 174190837
4-methylbenzenesulfonic acid;N-methyl-1-(3-nitrophenyl)methanesulfonamide (PubChem CID 174190837) has the molecular formula C15H18N2O7S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;N-methyl-1-(3-nitrophenyl)methanesulfonamide.
| Compound Name | 4-methylbenzenesulfonic acid;N-methyl-1-(3-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 174190837 |
| Molecular Formula | C15H18N2O7S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-methylbenzenesulfonic acid;N-methyl-1-(3-nitrophenyl)methanesulfonamide |
| SMILES | CNS(=O)(=O)Cc1cccc([N+](=O)[O-])c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H10N2O4S.C7H8O3S/c1-9-15(13,14)6-7-3-2-4-8(5-7)10(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,9H,6H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | VVQFUWUFCQBEGI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|