C16H18N2O4S — CID 92682818
1-(3-nitrophenyl)-N-(2,4,6-trimethylphenyl)methanesulfonamide (PubChem CID 92682818) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-(2,4,6-trimethylphenyl)methanesulfonamide.
| Compound Name | 1-(3-nitrophenyl)-N-(2,4,6-trimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 92682818 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(3-nitrophenyl)-N-(2,4,6-trimethylphenyl)methanesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)Cc2cccc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-11-7-12(2)16(13(3)8-11)17-23(21,22)10-14-5-4-6-15(9-14)18(19)20/h4-9,17H,10H2,1-3H3 |
| InChIKey | CZERFUXUKMAGMA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|